Urolithin B (1139-83-9)Manufacturer factory

Urolithin B

November 9, 2020

Urolithin B Specifications

Name: Urolithin B
Chemical Name: 3-Hydroxy-6H-dibenzo[b,d]pyran-6-one
CAS: 1139-83-9
Chemical Formula: C13H8O3
Molecular Weight: 212.2 g/mol
Color:  White powder
InChi Key: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES Code: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function: Urolithin B can improve mitochondrial and muscle function .

Urolithin B can improves muscle strength and endurance during aging.

Application: Urolithin B is an intestinal microbial metabolite of ellagitannis and exhibits potent anti-oxidant and pro-oxidant activies depending on the assay system and conditions. Urolithin B can also display estrogenic and/or anti-estrogenic activity.
Solubility: Easily soluble in N,N-dimethylformamide and dimethylmethylene. Sulfone, slightly soluble in methanol, ethanol, and ethyl acetate
Storage Temp: Hygroscopic, -20°C Freezer, Under inert atmosphere
Shipping Condition: Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs.