Urolithin B Specifications
Name: | Urolithin B |
Chemical Name: | 3-Hydroxy-6H-dibenzo[b,d]pyran-6-one |
CAS: | 1139-83-9 |
Chemical Formula: | C13H8O3 |
Molecular Weight: | 212.2 g/mol |
Color: | White powder |
InChi Key: | WXUQMTRHPNOXBV-UHFFFAOYSA-N |
SMILES Code: | O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1 |
Function: | Urolithin B can improve mitochondrial and muscle function . Urolithin B can improves muscle strength and endurance during aging. |
Application: | Urolithin B is an intestinal microbial metabolite of ellagitannis and exhibits potent anti-oxidant and pro-oxidant activies depending on the assay system and conditions. Urolithin B can also display estrogenic and/or anti-estrogenic activity. |
Solubility: | Easily soluble in N,N-dimethylformamide and dimethylmethylene. Sulfone, slightly soluble in methanol, ethanol, and ethyl acetate |
Storage Temp: | Hygroscopic, -20°C Freezer, Under inert atmosphere |
Shipping Condition: | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |